C21H27N3O4 — CID 58509565
8-hydroxy-1-[4-(1H-indole-3-carbonyl)piperazin-1-yl]octane-1,7-dione (PubChem CID 58509565) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 8-hydroxy-1-[4-(1H-indole-3-carbonyl)piperazin-1-yl]octane-1,7-dione.
| Compound Name | 8-hydroxy-1-[4-(1H-indole-3-carbonyl)piperazin-1-yl]octane-1,7-dione |
|---|---|
| PubChem CID | 58509565 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 8-hydroxy-1-[4-(1H-indole-3-carbonyl)piperazin-1-yl]octane-1,7-dione |
| SMILES | O=C(CO)CCCCCC(=O)N1CCN(C(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C21H27N3O4/c25-15-16(26)6-2-1-3-9-20(27)23-10-12-24(13-11-23)21(28)18-14-22-19-8-5-4-7-17(18)19/h4-5,7-8,14,22,25H,1-3,6,9-13,15H2 |
| InChIKey | RXIZTYXIVDMSBI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|