C19H25N3O2 — CID 110803979
1-[4-(1H-indole-3-carbonyl)piperazin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 110803979) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[4-(1H-indole-3-carbonyl)piperazin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(1H-indole-3-carbonyl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 110803979 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[4-(1H-indole-3-carbonyl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCN(C(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H25N3O2/c1-19(2,3)12-17(23)21-8-10-22(11-9-21)18(24)15-13-20-16-7-5-4-6-14(15)16/h4-7,13,20H,8-12H2,1-3H3 |
| InChIKey | MXACNGKIAULISB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |