C17H22N2O — CID 65281682
(4,4-dimethylazepan-1-yl)-(1H-indol-3-yl)methanone (PubChem CID 65281682) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (4,4-dimethylazepan-1-yl)-(1H-indol-3-yl)methanone.
| Compound Name | (4,4-dimethylazepan-1-yl)-(1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 65281682 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (4,4-dimethylazepan-1-yl)-(1H-indol-3-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C17H22N2O/c1-17(2)8-5-10-19(11-9-17)16(20)14-12-18-15-7-4-3-6-13(14)15/h3-4,6-7,12,18H,5,8-11H2,1-2H3 |
| InChIKey | RSPXRVGUDCCJIP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |