C21H20N2O2 — CID 15952131
1H-indol-3-yl(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)methanone (PubChem CID 15952131) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1H-indol-3-yl(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)methanone.
| Compound Name | 1H-indol-3-yl(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)methanone |
|---|---|
| PubChem CID | 15952131 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1H-indol-3-yl(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)N1CCC2(CC1)COc1ccccc12 |
| InChI | InChI=1S/C21H20N2O2/c24-20(16-13-22-18-7-3-1-5-15(16)18)23-11-9-21(10-12-23)14-25-19-8-4-2-6-17(19)21/h1-8,13,22H,9-12,14H2 |
| InChIKey | JNTGBZJXVPNMFD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |