C18H21N3O2 — CID 49206253
cyclopropyl-[4-(1H-indole-3-carbonyl)-1,4-diazepan-1-yl]methanone (PubChem CID 49206253) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is cyclopropyl-[4-(1H-indole-3-carbonyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(1H-indole-3-carbonyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 49206253 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | cyclopropyl-[4-(1H-indole-3-carbonyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)N1CCCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C18H21N3O2/c22-17(13-6-7-13)20-8-3-9-21(11-10-20)18(23)15-12-19-16-5-2-1-4-14(15)16/h1-2,4-5,12-13,19H,3,6-11H2 |
| InChIKey | RMVPNKREQBTAPK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |