C19H18F3N3O3S — CID 32705328
3-[[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methyl]benzonitrile (PubChem CID 32705328) has the molecular formula C19H18F3N3O3S and a molecular weight of 425.43 g/mol. Its IUPAC name is 3-[[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 32705328 |
| Molecular Formula | C19H18F3N3O3S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 3-[[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C19H18F3N3O3S/c20-19(21,22)28-17-4-6-18(7-5-17)29(26,27)25-10-8-24(9-11-25)14-16-3-1-2-15(12-16)13-23/h1-7,12H,8-11,14H2 |
| InChIKey | SDNGYFSQLWPTAZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |