C16H17F3N2O3S2 — CID 17422638
1-(thiophen-2-ylmethyl)-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine (PubChem CID 17422638) has the molecular formula C16H17F3N2O3S2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine.
| Compound Name | 1-(thiophen-2-ylmethyl)-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 17422638 |
| Molecular Formula | C16H17F3N2O3S2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H17F3N2O3S2/c17-16(18,19)24-13-3-5-15(6-4-13)26(22,23)21-9-7-20(8-10-21)12-14-2-1-11-25-14/h1-6,11H,7-10,12H2 |
| InChIKey | QUNJWMLBXWEEDR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |