C15H16F2N2O2S2 — CID 17446186
1-(3,4-difluorophenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazine (PubChem CID 17446186) has the molecular formula C15H16F2N2O2S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazine.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 17446186 |
| Molecular Formula | C15H16F2N2O2S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-4-(thiophen-2-ylmethyl)piperazine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H16F2N2O2S2/c16-14-4-3-13(10-15(14)17)23(20,21)19-7-5-18(6-8-19)11-12-2-1-9-22-12/h1-4,9-10H,5-8,11H2 |
| InChIKey | XECANDUEUHPQFM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |