C12H15ClF2N2O2S — CID 63397139
1-(2-chloroethyl)-4-(3,4-difluorophenyl)sulfonylpiperazine (PubChem CID 63397139) has the molecular formula C12H15ClF2N2O2S and a molecular weight of 324.78 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-(3,4-difluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(2-chloroethyl)-4-(3,4-difluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 63397139 |
| Molecular Formula | C12H15ClF2N2O2S |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-(2-chloroethyl)-4-(3,4-difluorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCN(CCCl)CC1 |
| InChI | InChI=1S/C12H15ClF2N2O2S/c13-3-4-16-5-7-17(8-6-16)20(18,19)10-1-2-11(14)12(15)9-10/h1-2,9H,3-8H2 |
| InChIKey | DCTZLTFQIOTETP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|