C14H15F2NO2S — CID 121187202
4-cyclopropylidene-1-(3,4-difluorophenyl)sulfonylpiperidine (PubChem CID 121187202) has the molecular formula C14H15F2NO2S and a molecular weight of 299.34 g/mol. Its IUPAC name is 4-cyclopropylidene-1-(3,4-difluorophenyl)sulfonylpiperidine.
| Compound Name | 4-cyclopropylidene-1-(3,4-difluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 121187202 |
| Molecular Formula | C14H15F2NO2S |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-cyclopropylidene-1-(3,4-difluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCC(=C2CC2)CC1 |
| InChI | InChI=1S/C14H15F2NO2S/c15-13-4-3-12(9-14(13)16)20(18,19)17-7-5-11(6-8-17)10-1-2-10/h3-4,9H,1-2,5-8H2 |
| InChIKey | OKDYGWOCZIEFLL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|