C19H18F2N2O2S2 — CID 24556207
1-(1-benzothiophen-3-ylmethyl)-4-(3,4-difluorophenyl)sulfonylpiperazine (PubChem CID 24556207) has the molecular formula C19H18F2N2O2S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylmethyl)-4-(3,4-difluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(1-benzothiophen-3-ylmethyl)-4-(3,4-difluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 24556207 |
| Molecular Formula | C19H18F2N2O2S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-(1-benzothiophen-3-ylmethyl)-4-(3,4-difluorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCN(Cc2csc3ccccc23)CC1 |
| InChI | InChI=1S/C19H18F2N2O2S2/c20-17-6-5-15(11-18(17)21)27(24,25)23-9-7-22(8-10-23)12-14-13-26-19-4-2-1-3-16(14)19/h1-6,11,13H,7-10,12H2 |
| InChIKey | HWJQRCNARKRBEY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |