C15H20N2OS — CID 60705027
2-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]ethanol (PubChem CID 60705027) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 60705027 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(Cc2csc3ccccc23)CC1 |
| InChI | InChI=1S/C15H20N2OS/c18-10-9-16-5-7-17(8-6-16)11-13-12-19-15-4-2-1-3-14(13)15/h1-4,12,18H,5-11H2 |
| InChIKey | NQTBNGFVLGNBEF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |