C24H28N2O6S — CID 17499333
1-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-3-phenoxypropan-2-ol;oxalic acid (PubChem CID 17499333) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is 1-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-3-phenoxypropan-2-ol;oxalic acid.
| Compound Name | 1-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-3-phenoxypropan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 17499333 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-[4-(1-benzothiophen-3-ylmethyl)piperazin-1-yl]-3-phenoxypropan-2-ol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OC(COc1ccccc1)CN1CCN(Cc2csc3ccccc23)CC1 |
| InChI | InChI=1S/C22H26N2O2S.C2H2O4/c25-19(16-26-20-6-2-1-3-7-20)15-24-12-10-23(11-13-24)14-18-17-27-22-9-5-4-8-21(18)22;3-1(4)2(5)6/h1-9,17,19,25H,10-16H2;(H,3,4)(H,5,6) |
| InChIKey | NVKSBJLSTPANCL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|