C16H22N2OS — CID 63738856
2-[4-(1-benzothiophen-3-ylmethyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 63738856) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[4-(1-benzothiophen-3-ylmethyl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(1-benzothiophen-3-ylmethyl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 63738856 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[4-(1-benzothiophen-3-ylmethyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | OCCN1CCCN(Cc2csc3ccccc23)CC1 |
| InChI | InChI=1S/C16H22N2OS/c19-11-10-17-6-3-7-18(9-8-17)12-14-13-20-16-5-2-1-4-15(14)16/h1-2,4-5,13,19H,3,6-12H2 |
| InChIKey | DWGXHMJBEJHQAQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |