C17H23NS — CID 66807220
(3S)-1-(1-benzothiophen-3-ylmethyl)-3-propan-2-ylpiperidine (PubChem CID 66807220) has the molecular formula C17H23NS and a molecular weight of 273.44 g/mol. Its IUPAC name is (3S)-1-(1-benzothiophen-3-ylmethyl)-3-propan-2-ylpiperidine.
| Compound Name | (3S)-1-(1-benzothiophen-3-ylmethyl)-3-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 66807220 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (3S)-1-(1-benzothiophen-3-ylmethyl)-3-propan-2-ylpiperidine |
| SMILES | CC(C)[C@@H]1CCCN(Cc2csc3ccccc23)C1 |
| InChI | InChI=1S/C17H23NS/c1-13(2)14-6-5-9-18(10-14)11-15-12-19-17-8-4-3-7-16(15)17/h3-4,7-8,12-14H,5-6,9-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | XVFXOXZRUHFKEN-CQSZACIVSA-N |
| XLogP | 4.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |