C14H17ClNS- — CID 53347465
1-(1-benzothiophen-3-ylmethyl)piperidine chloride (PubChem CID 53347465) has the molecular formula C14H17ClNS- and a molecular weight of 266.82 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylmethyl)piperidine chloride.
| Compound Name | 1-(1-benzothiophen-3-ylmethyl)piperidine chloride |
|---|---|
| PubChem CID | 53347465 |
| Molecular Formula | C14H17ClNS- |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-(1-benzothiophen-3-ylmethyl)piperidine chloride |
| SMILES | [Cl-].c1ccc2c(CN3CCCCC3)csc2c1 |
| InChI | InChI=1S/C14H17NS.ClH/c1-4-8-15(9-5-1)10-12-11-16-14-7-3-2-6-13(12)14;/h2-3,6-7,11H,1,4-5,8-10H2;1H/p-1 |
| InChIKey | MKDRHQBQBHMVNP-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |