C18H24N2S — CID 64869502
10-(1-benzothiophen-3-ylmethyl)-6,10-diazaspiro[4.6]undecane (PubChem CID 64869502) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is 10-(1-benzothiophen-3-ylmethyl)-6,10-diazaspiro[4.6]undecane.
| Compound Name | 10-(1-benzothiophen-3-ylmethyl)-6,10-diazaspiro[4.6]undecane |
|---|---|
| PubChem CID | 64869502 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 10-(1-benzothiophen-3-ylmethyl)-6,10-diazaspiro[4.6]undecane |
| SMILES | c1ccc2c(CN3CCCNC4(CCCC4)C3)csc2c1 |
| InChI | InChI=1S/C18H24N2S/c1-2-7-17-16(6-1)15(13-21-17)12-20-11-5-10-19-18(14-20)8-3-4-9-18/h1-2,6-7,13,19H,3-5,8-12,14H2 |
| InChIKey | DWIMQVRZMVBRNG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |