C15H22N2 — CID 86332339
(5R)-9-benzyl-1,9-diazaspiro[4.5]decane (PubChem CID 86332339) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is (5R)-9-benzyl-1,9-diazaspiro[4.5]decane.
| Compound Name | (5R)-9-benzyl-1,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 86332339 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (5R)-9-benzyl-1,9-diazaspiro[4.5]decane |
| SMILES | c1ccc(CN2CCC[C@]3(CCCN3)C2)cc1 |
| InChI | InChI=1S/C15H22N2/c1-2-6-14(7-3-1)12-17-11-5-9-15(13-17)8-4-10-16-15/h1-3,6-7,16H,4-5,8-13H2/t15-/m1/s1 |
| InChIKey | OOKMXRYWLZPJSM-OAHLLOKOSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |