C15H21FN2 — CID 97305383
(5S)-2-[(4-fluorophenyl)methyl]-2,6-diazaspiro[4.5]decane (PubChem CID 97305383) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is (5S)-2-[(4-fluorophenyl)methyl]-2,6-diazaspiro[4.5]decane.
| Compound Name | (5S)-2-[(4-fluorophenyl)methyl]-2,6-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 97305383 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (5S)-2-[(4-fluorophenyl)methyl]-2,6-diazaspiro[4.5]decane |
| SMILES | Fc1ccc(CN2CC[C@@]3(CCCCN3)C2)cc1 |
| InChI | InChI=1S/C15H21FN2/c16-14-5-3-13(4-6-14)11-18-10-8-15(12-18)7-1-2-9-17-15/h3-6,17H,1-2,7-12H2/t15-/m0/s1 |
| InChIKey | HOHNOSNADKTQRS-HNNXBMFYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |