C16H25N3 — CID 82623797
(9-benzyl-1,9-diazaspiro[4.5]decan-4-yl)methanamine (PubChem CID 82623797) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is (9-benzyl-1,9-diazaspiro[4.5]decan-4-yl)methanamine.
| Compound Name | (9-benzyl-1,9-diazaspiro[4.5]decan-4-yl)methanamine |
|---|---|
| PubChem CID | 82623797 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (9-benzyl-1,9-diazaspiro[4.5]decan-4-yl)methanamine |
| SMILES | NCC1CCNC12CCCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C16H25N3/c17-11-15-7-9-18-16(15)8-4-10-19(13-16)12-14-5-2-1-3-6-14/h1-3,5-6,15,18H,4,7-13,17H2 |
| InChIKey | XLHBPHGHSBMTBK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |