C17H24Cl2N2 — CID 64859040
11-[(2,6-dichlorophenyl)methyl]-7,11-diazaspiro[5.6]dodecane (PubChem CID 64859040) has the molecular formula C17H24Cl2N2 and a molecular weight of 327.30 g/mol. Its IUPAC name is 11-[(2,6-dichlorophenyl)methyl]-7,11-diazaspiro[5.6]dodecane.
| Compound Name | 11-[(2,6-dichlorophenyl)methyl]-7,11-diazaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 64859040 |
| Molecular Formula | C17H24Cl2N2 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 11-[(2,6-dichlorophenyl)methyl]-7,11-diazaspiro[5.6]dodecane |
| SMILES | Clc1cccc(Cl)c1CN1CCCNC2(CCCCC2)C1 |
| InChI | InChI=1S/C17H24Cl2N2/c18-15-6-4-7-16(19)14(15)12-21-11-5-10-20-17(13-21)8-2-1-3-9-17/h4,6-7,20H,1-3,5,8-13H2 |
| InChIKey | HDMOLYULPKKZAL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |