C16H23ClN2S — CID 119925714
1-[1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 119925714) has the molecular formula C16H23ClN2S and a molecular weight of 310.89 g/mol. Its IUPAC name is 1-[1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119925714 |
| Molecular Formula | C16H23ClN2S |
| Molecular Weight | 310.89 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-[1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCCN(Cc2csc3ccccc23)C1.Cl |
| InChI | InChI=1S/C16H22N2S.ClH/c1-12(17)13-5-4-8-18(9-13)10-14-11-19-16-7-3-2-6-15(14)16;/h2-3,6-7,11-13H,4-5,8-10,17H2,1H3;1H |
| InChIKey | SDQABQNLSWQKJP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |