C14H22ClIN2 — CID 119925517
1-[1-[(4-iodophenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 119925517) has the molecular formula C14H22ClIN2 and a molecular weight of 380.70 g/mol. Its IUPAC name is 1-[1-[(4-iodophenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[(4-iodophenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119925517 |
| Molecular Formula | C14H22ClIN2 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 1-[1-[(4-iodophenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCCN(Cc2ccc(I)cc2)C1.Cl |
| InChI | InChI=1S/C14H21IN2.ClH/c1-11(16)13-3-2-8-17(10-13)9-12-4-6-14(15)7-5-12;/h4-7,11,13H,2-3,8-10,16H2,1H3;1H |
| InChIKey | YBHNCPWSNNECQF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|