C14H21Cl2FN2 — CID 120966307
1-[1-[(2-chloro-5-fluorophenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120966307) has the molecular formula C14H21Cl2FN2 and a molecular weight of 307.24 g/mol. Its IUPAC name is 1-[1-[(2-chloro-5-fluorophenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[(2-chloro-5-fluorophenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120966307 |
| Molecular Formula | C14H21Cl2FN2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[1-[(2-chloro-5-fluorophenyl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCCN(Cc2cc(F)ccc2Cl)C1.Cl |
| InChI | InChI=1S/C14H20ClFN2.ClH/c1-10(17)11-3-2-6-18(8-11)9-12-7-13(16)4-5-14(12)15;/h4-5,7,10-11H,2-3,6,8-9,17H2,1H3;1H |
| InChIKey | DXRJXQGHLZSQDO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |