C11H15Cl2FN2 — CID 120966061
1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 120966061) has the molecular formula C11H15Cl2FN2 and a molecular weight of 265.16 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120966061 |
| Molecular Formula | C11H15Cl2FN2 |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(Cc2cc(F)ccc2Cl)C1 |
| InChI | InChI=1S/C11H14ClFN2.ClH/c12-11-2-1-9(13)5-8(11)6-15-4-3-10(14)7-15;/h1-2,5,10H,3-4,6-7,14H2;1H |
| InChIKey | JXWGOFRHWFGGKS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |