C11H12BrClFN — CID 102620188
3-bromo-1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidine (PubChem CID 102620188) has the molecular formula C11H12BrClFN and a molecular weight of 292.58 g/mol. Its IUPAC name is 3-bromo-1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidine.
| Compound Name | 3-bromo-1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 102620188 |
| Molecular Formula | C11H12BrClFN |
| Molecular Weight | 292.58 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 3-bromo-1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidine |
| SMILES | Fc1ccc(Cl)c(CN2CCC(Br)C2)c1 |
| InChI | InChI=1S/C11H12BrClFN/c12-9-3-4-15(7-9)6-8-5-10(14)1-2-11(8)13/h1-2,5,9H,3-4,6-7H2 |
| InChIKey | KFTCEZVALKALBH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|