C15H19ClFNO2 — CID 124830182
(2R)-4-[(2-chloro-5-fluorophenyl)methyl]-2-[(2R)-oxolan-2-yl]morpholine (PubChem CID 124830182) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is (2R)-4-[(2-chloro-5-fluorophenyl)methyl]-2-[(2R)-oxolan-2-yl]morpholine.
| Compound Name | (2R)-4-[(2-chloro-5-fluorophenyl)methyl]-2-[(2R)-oxolan-2-yl]morpholine |
|---|---|
| PubChem CID | 124830182 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2R)-4-[(2-chloro-5-fluorophenyl)methyl]-2-[(2R)-oxolan-2-yl]morpholine |
| SMILES | Fc1ccc(Cl)c(CN2CCO[C@@H]([C@H]3CCCO3)C2)c1 |
| InChI | InChI=1S/C15H19ClFNO2/c16-13-4-3-12(17)8-11(13)9-18-5-7-20-15(10-18)14-2-1-6-19-14/h3-4,8,14-15H,1-2,5-7,9-10H2/t14-,15-/m1/s1 |
| InChIKey | ZYYRNWLDZGRIMC-HUUCEWRRSA-N |
| XLogP | 2.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |