C12H16ClFN2 — CID 103576941
1-[(2-chloro-5-fluorophenyl)methyl]-4-methylpyrrolidin-3-amine (PubChem CID 103576941) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)methyl]-4-methylpyrrolidin-3-amine.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)methyl]-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 103576941 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)methyl]-4-methylpyrrolidin-3-amine |
| SMILES | CC1CN(Cc2cc(F)ccc2Cl)CC1N |
| InChI | InChI=1S/C12H16ClFN2/c1-8-5-16(7-12(8)15)6-9-4-10(14)2-3-11(9)13/h2-4,8,12H,5-7,15H2,1H3 |
| InChIKey | BWMKTLKVZVJYSB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |