C12H17BrCl2N2 — CID 120909523
1-[(3-bromo-4-chlorophenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 120909523) has the molecular formula C12H17BrCl2N2 and a molecular weight of 340.09 g/mol. Its IUPAC name is 1-[(3-bromo-4-chlorophenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(3-bromo-4-chlorophenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120909523 |
| Molecular Formula | C12H17BrCl2N2 |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 1-[(3-bromo-4-chlorophenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | CC1CN(Cc2ccc(Cl)c(Br)c2)CC1N.Cl |
| InChI | InChI=1S/C12H16BrClN2.ClH/c1-8-5-16(7-12(8)15)6-9-2-3-11(14)10(13)4-9;/h2-4,8,12H,5-7,15H2,1H3;1H |
| InChIKey | SAXBZHOCOUHIIM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |