C18H28ClN3O2 — CID 120909283
1-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methyl]-4-methylpyrrolidin-3-amine (PubChem CID 120909283) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 1-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methyl]-4-methylpyrrolidin-3-amine.
| Compound Name | 1-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methyl]-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120909283 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 1-[[3-chloro-4-(2-morpholin-4-ylethoxy)phenyl]methyl]-4-methylpyrrolidin-3-amine |
| SMILES | CC1CN(Cc2ccc(OCCN3CCOCC3)c(Cl)c2)CC1N |
| InChI | InChI=1S/C18H28ClN3O2/c1-14-11-22(13-17(14)20)12-15-2-3-18(16(19)10-15)24-9-6-21-4-7-23-8-5-21/h2-3,10,14,17H,4-9,11-13,20H2,1H3 |
| InChIKey | WPKNHDRHYYGEIR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |