C15H23ClN2O2 — CID 120909190
1-[(3-chloro-5-ethoxy-4-methoxyphenyl)methyl]-4-methylpyrrolidin-3-amine (PubChem CID 120909190) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 1-[(3-chloro-5-ethoxy-4-methoxyphenyl)methyl]-4-methylpyrrolidin-3-amine.
| Compound Name | 1-[(3-chloro-5-ethoxy-4-methoxyphenyl)methyl]-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120909190 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[(3-chloro-5-ethoxy-4-methoxyphenyl)methyl]-4-methylpyrrolidin-3-amine |
| SMILES | CCOc1cc(CN2CC(C)C(N)C2)cc(Cl)c1OC |
| InChI | InChI=1S/C15H23ClN2O2/c1-4-20-14-6-11(5-12(16)15(14)19-3)8-18-7-10(2)13(17)9-18/h5-6,10,13H,4,7-9,17H2,1-3H3 |
| InChIKey | BYPYXGGNMNMLOK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |