C14H22ClIN2O2 — CID 120909766
1-[(3-iodo-4,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 120909766) has the molecular formula C14H22ClIN2O2 and a molecular weight of 412.70 g/mol. Its IUPAC name is 1-[(3-iodo-4,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(3-iodo-4,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120909766 |
| Molecular Formula | C14H22ClIN2O2 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 1-[(3-iodo-4,5-dimethoxyphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | COc1cc(CN2CC(C)C(N)C2)cc(I)c1OC.Cl |
| InChI | InChI=1S/C14H21IN2O2.ClH/c1-9-6-17(8-12(9)16)7-10-4-11(15)14(19-3)13(5-10)18-2;/h4-5,9,12H,6-8,16H2,1-3H3;1H |
| InChIKey | RWPOBFSWKGBYTI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|