C15H24BrClN2O2 — CID 120909053
1-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 120909053) has the molecular formula C15H24BrClN2O2 and a molecular weight of 379.73 g/mol. Its IUPAC name is 1-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120909053 |
| Molecular Formula | C15H24BrClN2O2 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | CCOc1c(Br)cc(CN2CC(C)C(N)C2)cc1OC.Cl |
| InChI | InChI=1S/C15H23BrN2O2.ClH/c1-4-20-15-12(16)5-11(6-14(15)19-3)8-18-7-10(2)13(17)9-18;/h5-6,10,13H,4,7-9,17H2,1-3H3;1H |
| InChIKey | PGNCRZZVFGVROQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |