C9H10FIO2 — CID 118818993
5-(fluoromethyl)-1-iodo-2,3-dimethoxybenzene (PubChem CID 118818993) has the molecular formula C9H10FIO2 and a molecular weight of 296.08 g/mol. Its IUPAC name is 5-(fluoromethyl)-1-iodo-2,3-dimethoxybenzene.
| Compound Name | 5-(fluoromethyl)-1-iodo-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 118818993 |
| Molecular Formula | C9H10FIO2 |
| Molecular Weight | 296.08 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 5-(fluoromethyl)-1-iodo-2,3-dimethoxybenzene |
| SMILES | COc1cc(CF)cc(I)c1OC |
| InChI | InChI=1S/C9H10FIO2/c1-12-8-4-6(5-10)3-7(11)9(8)13-2/h3-4H,5H2,1-2H3 |
| InChIKey | ZVQQONOEEMSJNB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.08 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|