C14H22INO3 — CID 119134636
1-[(3-iodo-4,5-dimethoxyphenyl)methylamino]-3-methylbutan-2-ol (PubChem CID 119134636) has the molecular formula C14H22INO3 and a molecular weight of 379.24 g/mol. Its IUPAC name is 1-[(3-iodo-4,5-dimethoxyphenyl)methylamino]-3-methylbutan-2-ol.
| Compound Name | 1-[(3-iodo-4,5-dimethoxyphenyl)methylamino]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 119134636 |
| Molecular Formula | C14H22INO3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 1-[(3-iodo-4,5-dimethoxyphenyl)methylamino]-3-methylbutan-2-ol |
| SMILES | COc1cc(CNCC(O)C(C)C)cc(I)c1OC |
| InChI | InChI=1S/C14H22INO3/c1-9(2)12(17)8-16-7-10-5-11(15)14(19-4)13(6-10)18-3/h5-6,9,12,16-17H,7-8H2,1-4H3 |
| InChIKey | XLHJYKJOVMJLAX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|