C13H23N3O3 — CID 115119766
3-N-[(3,4,5-trimethoxyphenyl)methyl]propane-1,2,3-triamine (PubChem CID 115119766) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-N-[(3,4,5-trimethoxyphenyl)methyl]propane-1,2,3-triamine.
| Compound Name | 3-N-[(3,4,5-trimethoxyphenyl)methyl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119766 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 3-N-[(3,4,5-trimethoxyphenyl)methyl]propane-1,2,3-triamine |
| SMILES | COc1cc(CNCC(N)CN)cc(OC)c1OC |
| InChI | InChI=1S/C13H23N3O3/c1-17-11-4-9(7-16-8-10(15)6-14)5-12(18-2)13(11)19-3/h4-5,10,16H,6-8,14-15H2,1-3H3 |
| InChIKey | MHBQMBQTEGXXJE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |