C11H19N3O — CID 115119767
3-N-[(2-methoxyphenyl)methyl]propane-1,2,3-triamine (PubChem CID 115119767) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-N-[(2-methoxyphenyl)methyl]propane-1,2,3-triamine.
| Compound Name | 3-N-[(2-methoxyphenyl)methyl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119767 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 3-N-[(2-methoxyphenyl)methyl]propane-1,2,3-triamine |
| SMILES | COc1ccccc1CNCC(N)CN |
| InChI | InChI=1S/C11H19N3O/c1-15-11-5-3-2-4-9(11)7-14-8-10(13)6-12/h2-5,10,14H,6-8,12-13H2,1H3 |
| InChIKey | DBTKTILPZINUOW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |