C14H24N2O — CID 542258
N'-[(2-methoxyphenyl)methyl]hexane-1,6-diamine (PubChem CID 542258) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N'-[(2-methoxyphenyl)methyl]hexane-1,6-diamine.
| Compound Name | N'-[(2-methoxyphenyl)methyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 542258 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N'-[(2-methoxyphenyl)methyl]hexane-1,6-diamine |
| SMILES | COc1ccccc1CNCCCCCCN |
| InChI | InChI=1S/C14H24N2O/c1-17-14-9-5-4-8-13(14)12-16-11-7-3-2-6-10-15/h4-5,8-9,16H,2-3,6-7,10-12,15H2,1H3 |
| InChIKey | FLSYRUDBNQYGJQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|