C15H23NO3 — CID 82533082
5-[(2-methoxyphenyl)methylamino]pentyl acetate (PubChem CID 82533082) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 5-[(2-methoxyphenyl)methylamino]pentyl acetate.
| Compound Name | 5-[(2-methoxyphenyl)methylamino]pentyl acetate |
|---|---|
| PubChem CID | 82533082 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 5-[(2-methoxyphenyl)methylamino]pentyl acetate |
| SMILES | COc1ccccc1CNCCCCCOC(C)=O |
| InChI | InChI=1S/C15H23NO3/c1-13(17)19-11-7-3-6-10-16-12-14-8-4-5-9-15(14)18-2/h4-5,8-9,16H,3,6-7,10-12H2,1-2H3 |
| InChIKey | QDMHMTXZQAAWSS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|