C34H52N4O4 — CID 25149358
6-[(2-methoxyphenyl)methylamino]-N-[(1R,2R)-2-[6-[(2-methoxyphenyl)methylamino]hexanoylamino]cyclohexyl]hexanamide (PubChem CID 25149358) has the molecular formula C34H52N4O4 and a molecular weight of 580.81 g/mol. Its IUPAC name is 6-[(2-methoxyphenyl)methylamino]-N-[(1R,2R)-2-[6-[(2-methoxyphenyl)methylamino]hexanoylamino]cyclohexyl]hexanamide.
| Compound Name | 6-[(2-methoxyphenyl)methylamino]-N-[(1R,2R)-2-[6-[(2-methoxyphenyl)methylamino]hexanoylamino]cyclohexyl]hexanamide |
|---|---|
| PubChem CID | 25149358 |
| Molecular Formula | C34H52N4O4 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.40 |
| IUPAC Name | 6-[(2-methoxyphenyl)methylamino]-N-[(1R,2R)-2-[6-[(2-methoxyphenyl)methylamino]hexanoylamino]cyclohexyl]hexanamide |
| SMILES | COc1ccccc1CNCCCCCC(=O)N[C@@H]1CCCC[C@H]1NC(=O)CCCCCNCc1ccccc1OC |
| InChI | InChI=1S/C34H52N4O4/c1-41-31-19-11-7-15-27(31)25-35-23-13-3-5-21-33(39)37-29-17-9-10-18-30(29)38-34(40)22-6-4-14-24-36-26-28-16-8-12-20-32(28)42-2/h7-8,11-12,15-16,19-20,29-30,35-36H,3-6,9-10,13-14,17-18,21-26H2,1-2H3,(H,37,39)(H,38,40)/t29-,30-/m1/s1 |
| InChIKey | DVCMXOCDFWGIBH-LOYHVIPDSA-N |
| XLogP | 5.25 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|