C13H22N2O3 — CID 60889130
N'-[(3,4,5-trimethoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 60889130) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is N'-[(3,4,5-trimethoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(3,4,5-trimethoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60889130 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N'-[(3,4,5-trimethoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | COc1cc(CNCCCN)cc(OC)c1OC |
| InChI | InChI=1S/C13H22N2O3/c1-16-11-7-10(9-15-6-4-5-14)8-12(17-2)13(11)18-3/h7-8,15H,4-6,9,14H2,1-3H3 |
| InChIKey | UQZQLMHVPFUDQH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|