C16H25NO3 — CID 115639480
3-cyclopropyl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine (PubChem CID 115639480) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-cyclopropyl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-cyclopropyl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115639480 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3-cyclopropyl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine |
| SMILES | COc1cc(CNCCCC2CC2)cc(OC)c1OC |
| InChI | InChI=1S/C16H25NO3/c1-18-14-9-13(10-15(19-2)16(14)20-3)11-17-8-4-5-12-6-7-12/h9-10,12,17H,4-8,11H2,1-3H3 |
| InChIKey | AXCYGGRBSWYEOF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|