C17H27NO3 — CID 60733457
2-cyclopentyl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine (PubChem CID 60733457) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | 2-cyclopentyl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 60733457 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-cyclopentyl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(CNCCC2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H27NO3/c1-19-15-10-14(11-16(20-2)17(15)21-3)12-18-9-8-13-6-4-5-7-13/h10-11,13,18H,4-9,12H2,1-3H3 |
| InChIKey | JBEFUHZLPRMCBM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|