C13H22ClNO3 — CID 17293493
N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine;hydrochloride (PubChem CID 17293493) has the molecular formula C13H22ClNO3 and a molecular weight of 275.78 g/mol. Its IUPAC name is N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17293493 |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[(3,4,5-trimethoxyphenyl)methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1cc(OC)c(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C13H21NO3.ClH/c1-5-6-14-9-10-7-11(15-2)13(17-4)12(8-10)16-3;/h7-8,14H,5-6,9H2,1-4H3;1H |
| InChIKey | XYBIQTUTESUSOS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|