C19H34N2O5S — CID 70938746
2-methyl-N-[5-[(3,4,5-trimethoxyphenyl)methylamino]pentyl]propane-2-sulfonamide (PubChem CID 70938746) has the molecular formula C19H34N2O5S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-methyl-N-[5-[(3,4,5-trimethoxyphenyl)methylamino]pentyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[5-[(3,4,5-trimethoxyphenyl)methylamino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70938746 |
| Molecular Formula | C19H34N2O5S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-methyl-N-[5-[(3,4,5-trimethoxyphenyl)methylamino]pentyl]propane-2-sulfonamide |
| SMILES | COc1cc(CNCCCCCNS(=O)(=O)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C19H34N2O5S/c1-19(2,3)27(22,23)21-11-9-7-8-10-20-14-15-12-16(24-4)18(26-6)17(13-15)25-5/h12-13,20-21H,7-11,14H2,1-6H3 |
| InChIKey | NNZJDCQZLJGCIE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|