C16H27FN2O3S — CID 59231544
N-[5-(3-fluoro-4-methoxyanilino)pentyl]-2-methylpropane-2-sulfonamide (PubChem CID 59231544) has the molecular formula C16H27FN2O3S and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[5-(3-fluoro-4-methoxyanilino)pentyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[5-(3-fluoro-4-methoxyanilino)pentyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 59231544 |
| Molecular Formula | C16H27FN2O3S |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[5-(3-fluoro-4-methoxyanilino)pentyl]-2-methylpropane-2-sulfonamide |
| SMILES | COc1ccc(NCCCCCNS(=O)(=O)C(C)(C)C)cc1F |
| InChI | InChI=1S/C16H27FN2O3S/c1-16(2,3)23(20,21)19-11-7-5-6-10-18-13-8-9-15(22-4)14(17)12-13/h8-9,12,18-19H,5-7,10-11H2,1-4H3 |
| InChIKey | IRHFDZZHVUIPQM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|