C19H28N2O2S2 — CID 59230144
2-methyl-N-[5-(4-thiophen-2-ylanilino)pentyl]propane-2-sulfonamide (PubChem CID 59230144) has the molecular formula C19H28N2O2S2 and a molecular weight of 380.58 g/mol. Its IUPAC name is 2-methyl-N-[5-(4-thiophen-2-ylanilino)pentyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[5-(4-thiophen-2-ylanilino)pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230144 |
| Molecular Formula | C19H28N2O2S2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-methyl-N-[5-(4-thiophen-2-ylanilino)pentyl]propane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCCCNc1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C19H28N2O2S2/c1-19(2,3)25(22,23)21-14-6-4-5-13-20-17-11-9-16(10-12-17)18-8-7-15-24-18/h7-12,15,20-21H,4-6,13-14H2,1-3H3 |
| InChIKey | QUOBDWXZBDYJBX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|