C19H32N2O3S — CID 70939642
N-[5-[3-(cyclopropylmethoxy)anilino]pentyl]-2-methylpropane-2-sulfonamide (PubChem CID 70939642) has the molecular formula C19H32N2O3S and a molecular weight of 368.54 g/mol. Its IUPAC name is N-[5-[3-(cyclopropylmethoxy)anilino]pentyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[5-[3-(cyclopropylmethoxy)anilino]pentyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70939642 |
| Molecular Formula | C19H32N2O3S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-[5-[3-(cyclopropylmethoxy)anilino]pentyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCCCNc1cccc(OCC2CC2)c1 |
| InChI | InChI=1S/C19H32N2O3S/c1-19(2,3)25(22,23)21-13-6-4-5-12-20-17-8-7-9-18(14-17)24-15-16-10-11-16/h7-9,14,16,20-21H,4-6,10-13,15H2,1-3H3 |
| InChIKey | SQJBIVRFDWJHMP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|