C21H37N3O5S2 — CID 118376644
N-[5-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]pentyl]-2-methylpropane-2-sulfonamide (PubChem CID 118376644) has the molecular formula C21H37N3O5S2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N-[5-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]pentyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[5-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]pentyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 118376644 |
| Molecular Formula | C21H37N3O5S2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-[5-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]pentyl]-2-methylpropane-2-sulfonamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cccc(NCCCCCNS(=O)(=O)C(C)(C)C)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H37N3O5S2/c1-17-15-24(16-18(2)29-17)30(25,26)20-11-9-10-19(14-20)22-12-7-6-8-13-23-31(27,28)21(3,4)5/h9-11,14,17-18,22-23H,6-8,12-13,15-16H2,1-5H3/t17-,18+ |
| InChIKey | SVXMXIDSRHLQLR-HDICACEKSA-N |
| XLogP | 2.78 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|