C20H35N3O3S — CID 59230914
N-[5-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]pentyl]propane-2-sulfonamide (PubChem CID 59230914) has the molecular formula C20H35N3O3S and a molecular weight of 397.59 g/mol. Its IUPAC name is N-[5-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230914 |
| Molecular Formula | C20H35N3O3S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[5-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNc1cccc(N2C[C@@H](C)O[C@@H](C)C2)c1 |
| InChI | InChI=1S/C20H35N3O3S/c1-16(2)27(24,25)22-12-7-5-6-11-21-19-9-8-10-20(13-19)23-14-17(3)26-18(4)15-23/h8-10,13,16-18,21-22H,5-7,11-12,14-15H2,1-4H3/t17-,18+ |
| InChIKey | DCFBLPJLOJXYTO-HDICACEKSA-N |
| XLogP | 3.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|